C19H24ClN5O3S — CID 26126632
3-[(2-chlorophenyl)sulfonylamino]-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]propanamide (PubChem CID 26126632) has the molecular formula C19H24ClN5O3S and a molecular weight of 437.95 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfonylamino]-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]propanamide.
| Compound Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 26126632 |
| Molecular Formula | C19H24ClN5O3S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]propanamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CCNS(=O)(=O)c3ccccc3Cl)cn2)CC1 |
| InChI | InChI=1S/C19H24ClN5O3S/c1-24-10-12-25(13-11-24)18-7-6-15(14-21-18)23-19(26)8-9-22-29(27,28)17-5-3-2-4-16(17)20/h2-7,14,22H,8-13H2,1H3,(H,23,26) |
| InChIKey | OGZKFZKDNCVVTL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |