C16H17ClN4O3S — CID 113011206
2-chloro-N-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]benzenesulfonamide (PubChem CID 113011206) has the molecular formula C16H17ClN4O3S and a molecular weight of 380.86 g/mol. Its IUPAC name is 2-chloro-N-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113011206 |
| Molecular Formula | C16H17ClN4O3S |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-chloro-N-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]benzenesulfonamide |
| SMILES | O=CN1CCN(c2ccc(NS(=O)(=O)c3ccccc3Cl)cn2)CC1 |
| InChI | InChI=1S/C16H17ClN4O3S/c17-14-3-1-2-4-15(14)25(23,24)19-13-5-6-16(18-11-13)21-9-7-20(12-22)8-10-21/h1-6,11-12,19H,7-10H2 |
| InChIKey | ZNDYGIOKKICIPV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|