C16H17Cl2N3O3S — CID 74225889
2,4-dichloro-5-methyl-N-(6-morpholin-4-yl-3-pyridinyl)benzenesulfonamide (PubChem CID 74225889) has the molecular formula C16H17Cl2N3O3S and a molecular weight of 402.30 g/mol. Its IUPAC name is 2,4-dichloro-5-methyl-N-(6-morpholin-4-yl-3-pyridinyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-5-methyl-N-(6-morpholin-4-yl-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 74225889 |
| Molecular Formula | C16H17Cl2N3O3S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2,4-dichloro-5-methyl-N-(6-morpholin-4-yl-3-pyridinyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(N3CCOCC3)nc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2N3O3S/c1-11-8-15(14(18)9-13(11)17)25(22,23)20-12-2-3-16(19-10-12)21-4-6-24-7-5-21/h2-3,8-10,20H,4-7H2,1H3 |
| InChIKey | OIRLTPSLIGAVQV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |