C15H17ClN4O2S — CID 113039063
2-chloro-N-(6-piperidin-1-ylpyridazin-3-yl)benzenesulfonamide (PubChem CID 113039063) has the molecular formula C15H17ClN4O2S and a molecular weight of 352.85 g/mol. Its IUPAC name is 2-chloro-N-(6-piperidin-1-ylpyridazin-3-yl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(6-piperidin-1-ylpyridazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113039063 |
| Molecular Formula | C15H17ClN4O2S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-chloro-N-(6-piperidin-1-ylpyridazin-3-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(N2CCCCC2)nn1)c1ccccc1Cl |
| InChI | InChI=1S/C15H17ClN4O2S/c16-12-6-2-3-7-13(12)23(21,22)19-14-8-9-15(18-17-14)20-10-4-1-5-11-20/h2-3,6-9H,1,4-5,10-11H2,(H,17,19) |
| InChIKey | MEOVYMPTZKULPX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |