C21H22N4O8S — CID 6219763
3-(4-morpholin-4-ylsulfonylphenyl)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]propanamide (PubChem CID 6219763) has the molecular formula C21H22N4O8S and a molecular weight of 490.49 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]propanamide.
| Compound Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 6219763 |
| Molecular Formula | C21H22N4O8S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)N/N=C\c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C21H22N4O8S/c26-21(23-22-13-16-11-19-20(33-14-32-19)12-18(16)25(27)28)6-3-15-1-4-17(5-2-15)34(29,30)24-7-9-31-10-8-24/h1-2,4-5,11-13H,3,6-10,14H2,(H,23,26)/b22-13- |
| InChIKey | GNRUWLPDMJFMGY-XKZIYDEJSA-N |
| XLogP | 1.43 |
| TPSA | 149.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|