C20H22BrN3O4S — CID 2351057
N-[(2-bromophenyl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 2351057) has the molecular formula C20H22BrN3O4S and a molecular weight of 480.38 g/mol. Its IUPAC name is N-[(2-bromophenyl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | N-[(2-bromophenyl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 2351057 |
| Molecular Formula | C20H22BrN3O4S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | N-[(2-bromophenyl)methylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NN=Cc1ccccc1Br |
| InChI | InChI=1S/C20H22BrN3O4S/c21-19-4-2-1-3-17(19)15-22-23-20(25)10-7-16-5-8-18(9-6-16)29(26,27)24-11-13-28-14-12-24/h1-6,8-9,15H,7,10-14H2,(H,23,25) |
| InChIKey | YUQGJDXQEIIDND-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|