C23H26BrN3O6 — CID 3660839
N-[6-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-6-oxohexyl]-3,4-dimethoxybenzamide (PubChem CID 3660839) has the molecular formula C23H26BrN3O6 and a molecular weight of 520.38 g/mol. Its IUPAC name is N-[6-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-6-oxohexyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[6-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-6-oxohexyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3660839 |
| Molecular Formula | C23H26BrN3O6 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | N-[6-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-6-oxohexyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCCCC(=O)NN=Cc2cc3c(cc2Br)OCO3)cc1OC |
| InChI | InChI=1S/C23H26BrN3O6/c1-30-18-8-7-15(10-19(18)31-2)23(29)25-9-5-3-4-6-22(28)27-26-13-16-11-20-21(12-17(16)24)33-14-32-20/h7-8,10-13H,3-6,9,14H2,1-2H3,(H,25,29)(H,27,28) |
| InChIKey | WDHNDOPUJFNOKE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|