C14H8Br4N2O2 — CID 5333871
4-bromo-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]benzamide (PubChem CID 5333871) has the molecular formula C14H8Br4N2O2 and a molecular weight of 555.85 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-bromo-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5333871 |
| Molecular Formula | C14H8Br4N2O2 |
| Molecular Weight | 555.85 g/mol |
| Exact Mass | 551.73 |
| IUPAC Name | 4-bromo-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1c(Br)cc(Br)c(O)c1Br)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H8Br4N2O2/c15-8-3-1-7(2-4-8)14(22)20-19-6-9-10(16)5-11(17)13(21)12(9)18/h1-6,21H,(H,20,22)/b19-6- |
| InChIKey | GUUBPDFTOQIVIN-SWNXQHNESA-N |
| XLogP | 5.21 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.85 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|