C24H19N3OS — CID 112825489
1-(1,3-benzothiazol-2-ylmethyl)-1-methyl-3-[3-(2-phenylethynyl)phenyl]urea (PubChem CID 112825489) has the molecular formula C24H19N3OS and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-1-methyl-3-[3-(2-phenylethynyl)phenyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-1-methyl-3-[3-(2-phenylethynyl)phenyl]urea |
|---|---|
| PubChem CID | 112825489 |
| Molecular Formula | C24H19N3OS |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-1-methyl-3-[3-(2-phenylethynyl)phenyl]urea |
| SMILES | CN(Cc1nc2ccccc2s1)C(=O)Nc1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H19N3OS/c1-27(17-23-26-21-12-5-6-13-22(21)29-23)24(28)25-20-11-7-10-19(16-20)15-14-18-8-3-2-4-9-18/h2-13,16H,17H2,1H3,(H,25,28) |
| InChIKey | ZIVIUZKTXUTNCD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|