C16H19N2OS+ — CID 91575081
CID 91575081 (PubChem CID 91575081) has the molecular formula C16H19N2OS+ and a molecular weight of 287.41 g/mol.
| Compound Name | CID 91575081 |
|---|---|
| PubChem CID | 91575081 |
| Molecular Formula | C16H19N2OS+ |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | — |
| SMILES | [CH2+]c1ccc(CCNC(=O)C(NC)c2cccs2)cc1 |
| InChI | InChI=1S/C16H18N2OS/c1-12-5-7-13(8-6-12)9-10-18-16(19)15(17-2)14-4-3-11-20-14/h3-8,11,15,17H,1,9-10H2,2H3/p+1 |
| InChIKey | BNCYNLKJPRJZQW-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|