C23H21Cl2FN2O3S — CID 162676137
2-(3-chloro-N-(2-chloro-2-fluoroacetyl)-4-methoxyanilino)-N-(2-phenylethyl)-2-thiophen-2-ylacetamide (PubChem CID 162676137) has the molecular formula C23H21Cl2FN2O3S and a molecular weight of 495.40 g/mol. Its IUPAC name is 2-(3-chloro-N-(2-chloro-2-fluoroacetyl)-4-methoxyanilino)-N-(2-phenylethyl)-2-thiophen-2-ylacetamide.
| Compound Name | 2-(3-chloro-N-(2-chloro-2-fluoroacetyl)-4-methoxyanilino)-N-(2-phenylethyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 162676137 |
| Molecular Formula | C23H21Cl2FN2O3S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 2-(3-chloro-N-(2-chloro-2-fluoroacetyl)-4-methoxyanilino)-N-(2-phenylethyl)-2-thiophen-2-ylacetamide |
| SMILES | COc1ccc(N(C(=O)C(F)Cl)C(C(=O)NCCc2ccccc2)c2cccs2)cc1Cl |
| InChI | InChI=1S/C23H21Cl2FN2O3S/c1-31-18-10-9-16(14-17(18)24)28(23(30)21(25)26)20(19-8-5-13-32-19)22(29)27-12-11-15-6-3-2-4-7-15/h2-10,13-14,20-21H,11-12H2,1H3,(H,27,29) |
| InChIKey | FUETXMTUQMSGMM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|