C24H21ClFN3O2 — CID 172709697
N-[1-(4-aminophenyl)-2-(benzylamino)-2-oxoethyl]-N-(3-chlorophenyl)-2-fluoroprop-2-enamide (PubChem CID 172709697) has the molecular formula C24H21ClFN3O2 and a molecular weight of 437.90 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)-2-(benzylamino)-2-oxoethyl]-N-(3-chlorophenyl)-2-fluoroprop-2-enamide.
| Compound Name | N-[1-(4-aminophenyl)-2-(benzylamino)-2-oxoethyl]-N-(3-chlorophenyl)-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 172709697 |
| Molecular Formula | C24H21ClFN3O2 |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-[1-(4-aminophenyl)-2-(benzylamino)-2-oxoethyl]-N-(3-chlorophenyl)-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)N(c1cccc(Cl)c1)C(C(=O)NCc1ccccc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C24H21ClFN3O2/c1-16(26)24(31)29(21-9-5-8-19(25)14-21)22(18-10-12-20(27)13-11-18)23(30)28-15-17-6-3-2-4-7-17/h2-14,22H,1,15,27H2,(H,28,30) |
| InChIKey | FBRJXLZDWWMQNN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|