C25H29ClFN4O4S- — CID 137496953
(2S)-1-[[2-(N-[1-(2-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-3-fluoroanilino)-2-oxoethyl]-sulfinatoamino]-2-methylaziridine (PubChem CID 137496953) has the molecular formula C25H29ClFN4O4S- and a molecular weight of 536.05 g/mol. Its IUPAC name is (2S)-1-[[2-(N-[1-(2-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-3-fluoroanilino)-2-oxoethyl]-sulfinatoamino]-2-methylaziridine.
| Compound Name | (2S)-1-[[2-(N-[1-(2-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-3-fluoroanilino)-2-oxoethyl]-sulfinatoamino]-2-methylaziridine |
|---|---|
| PubChem CID | 137496953 |
| Molecular Formula | C25H29ClFN4O4S- |
| Molecular Weight | 536.05 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | (2S)-1-[[2-(N-[1-(2-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-3-fluoroanilino)-2-oxoethyl]-sulfinatoamino]-2-methylaziridine |
| SMILES | C[C@H]1CN1N(CC(=O)N(c1cccc(F)c1)C(C(=O)NC1CCCCC1)c1ccccc1Cl)S(=O)[O-] |
| InChI | InChI=1S/C25H30ClFN4O4S/c1-17-15-29(17)30(36(34)35)16-23(32)31(20-11-7-8-18(27)14-20)24(21-12-5-6-13-22(21)26)25(33)28-19-9-3-2-4-10-19/h5-8,11-14,17,19,24H,2-4,9-10,15-16H2,1H3,(H,28,33)(H,34,35)/p-1/t17-,24?,29?/m0/s1 |
| InChIKey | LFLOJMUGGOYNKL-BRDCABSVSA-M |
| XLogP | 3.72 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.05 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|