C28H38FN3O2 — CID 123840850
N-cyclohexyl-3-ethenyl-2-[[2-(4-fluoroanilino)acetyl]-(2-methylpenta-2,4-dienyl)amino]-4-methylpent-3-enamide (PubChem CID 123840850) has the molecular formula C28H38FN3O2 and a molecular weight of 467.63 g/mol. Its IUPAC name is N-cyclohexyl-3-ethenyl-2-[[2-(4-fluoroanilino)acetyl]-(2-methylpenta-2,4-dienyl)amino]-4-methylpent-3-enamide.
| Compound Name | N-cyclohexyl-3-ethenyl-2-[[2-(4-fluoroanilino)acetyl]-(2-methylpenta-2,4-dienyl)amino]-4-methylpent-3-enamide |
|---|---|
| PubChem CID | 123840850 |
| Molecular Formula | C28H38FN3O2 |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | N-cyclohexyl-3-ethenyl-2-[[2-(4-fluoroanilino)acetyl]-(2-methylpenta-2,4-dienyl)amino]-4-methylpent-3-enamide |
| SMILES | C=CC=C(C)CN(C(=O)CNc1ccc(F)cc1)C(C(=O)NC1CCCCC1)C(C=C)=C(C)C |
| InChI | InChI=1S/C28H38FN3O2/c1-6-11-21(5)19-32(26(33)18-30-23-16-14-22(29)15-17-23)27(25(7-2)20(3)4)28(34)31-24-12-9-8-10-13-24/h6-7,11,14-17,24,27,30H,1-2,8-10,12-13,18-19H2,3-5H3,(H,31,34) |
| InChIKey | OBPJYRBYBYMDLZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|