C26H34N2O5 — CID 3216570
2-[acetyl(benzyl)amino]-N-cyclohexyl-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 3216570) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[acetyl(benzyl)amino]-N-cyclohexyl-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[acetyl(benzyl)amino]-N-cyclohexyl-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3216570 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[acetyl(benzyl)amino]-N-cyclohexyl-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(C(C(=O)NC2CCCCC2)N(Cc2ccccc2)C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H34N2O5/c1-18(29)28(17-19-11-7-5-8-12-19)24(26(30)27-21-13-9-6-10-14-21)20-15-22(31-2)25(33-4)23(16-20)32-3/h5,7-8,11-12,15-16,21,24H,6,9-10,13-14,17H2,1-4H3,(H,27,30) |
| InChIKey | ODISRJHURAFWSI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |