C25H34N2O3S — CID 132612002
N-tert-butyl-2-[(4-methoxyphenyl)methyl-(3-phenylsulfanylpropanoyl)amino]butanamide (PubChem CID 132612002) has the molecular formula C25H34N2O3S and a molecular weight of 442.63 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-methoxyphenyl)methyl-(3-phenylsulfanylpropanoyl)amino]butanamide.
| Compound Name | N-tert-butyl-2-[(4-methoxyphenyl)methyl-(3-phenylsulfanylpropanoyl)amino]butanamide |
|---|---|
| PubChem CID | 132612002 |
| Molecular Formula | C25H34N2O3S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | N-tert-butyl-2-[(4-methoxyphenyl)methyl-(3-phenylsulfanylpropanoyl)amino]butanamide |
| SMILES | CCC(C(=O)NC(C)(C)C)N(Cc1ccc(OC)cc1)C(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C25H34N2O3S/c1-6-22(24(29)26-25(2,3)4)27(18-19-12-14-20(30-5)15-13-19)23(28)16-17-31-21-10-8-7-9-11-21/h7-15,22H,6,16-18H2,1-5H3,(H,26,29) |
| InChIKey | WTALOUHWTMWFQD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |