C24H25N3O3S — CID 41479571
N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-2-(N-benzyl-4-methoxyanilino)acetamide (PubChem CID 41479571) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-2-(N-benzyl-4-methoxyanilino)acetamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-2-(N-benzyl-4-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 41479571 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-2-(N-benzyl-4-methoxyanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2ccccc2SCC(N)=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25N3O3S/c1-30-20-13-11-19(12-14-20)27(15-18-7-3-2-4-8-18)16-24(29)26-21-9-5-6-10-22(21)31-17-23(25)28/h2-14H,15-17H2,1H3,(H2,25,28)(H,26,29) |
| InChIKey | QYWZPGPJZPBDSA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|