C21H21FN2O2 — CID 9054040
N-(2-fluorophenyl)-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]acetamide (PubChem CID 9054040) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 9054040 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]acetamide |
| SMILES | COc1ccc2cc(CN(C)CC(=O)Nc3ccccc3F)ccc2c1 |
| InChI | InChI=1S/C21H21FN2O2/c1-24(14-21(25)23-20-6-4-3-5-19(20)22)13-15-7-8-17-12-18(26-2)10-9-16(17)11-15/h3-12H,13-14H2,1-2H3,(H,23,25) |
| InChIKey | PHLBRSMDBHTJEH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |