C20H18ClFN2O — CID 17487361
N-(4-chloro-2-fluorophenyl)-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide (PubChem CID 17487361) has the molecular formula C20H18ClFN2O and a molecular weight of 356.83 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 17487361 |
| Molecular Formula | C20H18ClFN2O |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)cc1F)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H18ClFN2O/c1-24(12-14-6-7-15-4-2-3-5-16(15)10-14)13-20(25)23-19-9-8-17(21)11-18(19)22/h2-11H,12-13H2,1H3,(H,23,25) |
| InChIKey | TXWCCBCQZIGFPX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |