C19H20ClFN2O6 — CID 17401827
N-(5-chloro-2-fluorophenyl)-2-[(4-methoxyphenyl)methyl-methylamino]acetamide;oxalic acid (PubChem CID 17401827) has the molecular formula C19H20ClFN2O6 and a molecular weight of 426.83 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-[(4-methoxyphenyl)methyl-methylamino]acetamide;oxalic acid.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-[(4-methoxyphenyl)methyl-methylamino]acetamide;oxalic acid |
|---|---|
| PubChem CID | 17401827 |
| Molecular Formula | C19H20ClFN2O6 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-[(4-methoxyphenyl)methyl-methylamino]acetamide;oxalic acid |
| SMILES | COc1ccc(CN(C)CC(=O)Nc2cc(Cl)ccc2F)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H18ClFN2O2.C2H2O4/c1-21(10-12-3-6-14(23-2)7-4-12)11-17(22)20-16-9-13(18)5-8-15(16)19;3-1(4)2(5)6/h3-9H,10-11H2,1-2H3,(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | OQUGNTQBUWVKKW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|