C24H29NO5 — CID 4163806
butyl 3-[3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoylamino]benzoate (PubChem CID 4163806) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is butyl 3-[3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoylamino]benzoate.
| Compound Name | butyl 3-[3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 4163806 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | butyl 3-[3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoylamino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=O)C=Cc2ccc(OC(C)C)c(OC)c2)c1 |
| InChI | InChI=1S/C24H29NO5/c1-5-6-14-29-24(27)19-8-7-9-20(16-19)25-23(26)13-11-18-10-12-21(30-17(2)3)22(15-18)28-4/h7-13,15-17H,5-6,14H2,1-4H3,(H,25,26) |
| InChIKey | DIAIPAXIFWEXTG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|