C22H32N4O3S — CID 110930386
N-[3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide (PubChem CID 110930386) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is N-[3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110930386 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-[3-[[N-(3-ethoxypropyl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCOCCCN/C(=N\Cc1ccc(OC)cc1)NCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C22H32N4O3S/c1-3-29-15-6-14-25-22(26-17-18-8-10-19(28-2)11-9-18)24-13-5-12-23-21(27)20-7-4-16-30-20/h4,7-11,16H,3,5-6,12-15,17H2,1-2H3,(H,23,27)(H2,24,25,26) |
| InChIKey | IJBXFOHFLQKQFL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|