C19H34IN3O3S — CID 111715760
1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine;hydroiodide (PubChem CID 111715760) has the molecular formula C19H34IN3O3S and a molecular weight of 511.47 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111715760 |
| Molecular Formula | C19H34IN3O3S |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCCS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C19H33N3O3S.HI/c1-4-20-19(22-15-17(10-12-23)14-16(2)3)21-11-13-26(24,25)18-8-6-5-7-9-18;/h5-9,16-17,23H,4,10-15H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | XNLGWYIDEUXNIW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|