C20H27ClIN3O2S — CID 111196445
1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111196445) has the molecular formula C20H27ClIN3O2S and a molecular weight of 535.88 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111196445 |
| Molecular Formula | C20H27ClIN3O2S |
| Molecular Weight | 535.88 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CS(C)(=O)=O)cc1)NCCc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C20H26ClN3O2S.HI/c1-3-22-20(23-13-12-16-8-10-19(21)11-9-16)24-14-17-4-6-18(7-5-17)15-27(2,25)26;/h4-11H,3,12-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | RJTADMJBRZIFMY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.88 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|