C19H30F3N5 — CID 111968493
1-ethyl-3-(2-pyridin-2-ylethyl)-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine (PubChem CID 111968493) has the molecular formula C19H30F3N5 and a molecular weight of 385.48 g/mol. Its IUPAC name is 1-ethyl-3-(2-pyridin-2-ylethyl)-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine.
| Compound Name | 1-ethyl-3-(2-pyridin-2-ylethyl)-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111968493 |
| Molecular Formula | C19H30F3N5 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 1-ethyl-3-(2-pyridin-2-ylethyl)-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCC1CCN(CC(F)(F)F)CC1)NCCc1ccccn1 |
| InChI | InChI=1S/C19H30F3N5/c1-2-23-18(26-12-7-17-5-3-4-10-24-17)25-11-6-16-8-13-27(14-9-16)15-19(20,21)22/h3-5,10,16H,2,6-9,11-15H2,1H3,(H2,23,25,26) |
| InChIKey | RSYDLERYUHXKPU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|