C18H29F3N4O2S — CID 111613926
1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 111613926) has the molecular formula C18H29F3N4O2S and a molecular weight of 422.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111613926 |
| Molecular Formula | C18H29F3N4O2S |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)NCCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H29F3N4O2S/c1-4-22-17(23-11-5-13-25(2)14-18(19,20)21)24-12-10-15-6-8-16(9-7-15)28(3,26)27/h6-9H,4-5,10-14H2,1-3H3,(H2,22,23,24) |
| InChIKey | DNMQNAFAHGTVSB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|