C18H25N5O2S — CID 111522224
2-[4-[2-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide (PubChem CID 111522224) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is 2-[4-[2-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide.
| Compound Name | 2-[4-[2-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111522224 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-[4-[2-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCc1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C18H25N5O2S/c1-3-20-18(23-11-17-22-10-13(2)26-17)21-9-8-14-4-6-15(7-5-14)25-12-16(19)24/h4-7,10H,3,8-9,11-12H2,1-2H3,(H2,19,24)(H2,20,21,23) |
| InChIKey | ZMZGXYUYEOLNGZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|