C26H30N4O — CID 109389748
3-[[[(2,3-diphenylpropylamino)-(ethylamino)methylidene]amino]methyl]benzamide (PubChem CID 109389748) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-[[[(2,3-diphenylpropylamino)-(ethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | 3-[[[(2,3-diphenylpropylamino)-(ethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 109389748 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 3-[[[(2,3-diphenylpropylamino)-(ethylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)NCC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30N4O/c1-2-28-26(29-18-21-12-9-15-23(17-21)25(27)31)30-19-24(22-13-7-4-8-14-22)16-20-10-5-3-6-11-20/h3-15,17,24H,2,16,18-19H2,1H3,(H2,27,31)(H2,28,29,30) |
| InChIKey | LYXPSHNSSQZMAQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|