C20H31F2IN4O — CID 109451264
4-(2,5-difluorophenyl)-N-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109451264) has the molecular formula C20H31F2IN4O and a molecular weight of 508.40 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,5-difluorophenyl)-N-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109451264 |
| Molecular Formula | C20H31F2IN4O |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOCCC1(CN/C(=N\C)N2CCN(c3cc(F)ccc3F)CC2)CC1.I |
| InChI | InChI=1S/C20H30F2N4O.HI/c1-3-27-13-8-20(6-7-20)15-24-19(23-2)26-11-9-25(10-12-26)18-14-16(21)4-5-17(18)22;/h4-5,14H,3,6-13,15H2,1-2H3,(H,23,24);1H |
| InChIKey | NNVHACDBXPYSTP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|