C21H32F2N4O — CID 109451625
4-(2,5-difluorophenyl)-N'-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 109451625) has the molecular formula C21H32F2N4O and a molecular weight of 394.51 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451625 |
| Molecular Formula | C21H32F2N4O |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(CCOCC)CC1)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C21H32F2N4O/c1-3-24-20(25-16-21(7-8-21)9-14-28-4-2)27-12-10-26(11-13-27)19-15-17(22)5-6-18(19)23/h5-6,15H,3-4,7-14,16H2,1-2H3,(H,24,25) |
| InChIKey | GVJDAGBVGHAOKD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|