C22H31F2N7O — CID 109451373
4-(2,5-difluorophenyl)-N-ethyl-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperazine-1-carboximidamide (PubChem CID 109451373) has the molecular formula C22H31F2N7O and a molecular weight of 447.53 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451373 |
| Molecular Formula | C22H31F2N7O |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCn1nc2n(c1=O)CCCC2)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C22H31F2N7O/c1-2-25-21(26-9-5-11-31-22(32)30-10-4-3-6-20(30)27-31)29-14-12-28(13-15-29)19-16-17(23)7-8-18(19)24/h7-8,16H,2-6,9-15H2,1H3,(H,25,26) |
| InChIKey | CWUUUAZJQMNQEB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|