C21H30IN5S — CID 111557033
2-methyl-1-[(1-phenylsulfanylcyclopropyl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide (PubChem CID 111557033) has the molecular formula C21H30IN5S and a molecular weight of 511.48 g/mol. Its IUPAC name is 2-methyl-1-[(1-phenylsulfanylcyclopropyl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-phenylsulfanylcyclopropyl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111557033 |
| Molecular Formula | C21H30IN5S |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 2-methyl-1-[(1-phenylsulfanylcyclopropyl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCNc1ccccn1)NCC1(Sc2ccccc2)CC1.I |
| InChI | InChI=1S/C21H29N5S.HI/c1-22-20(25-16-8-7-15-24-19-11-5-6-14-23-19)26-17-21(12-13-21)27-18-9-3-2-4-10-18;/h2-6,9-11,14H,7-8,12-13,15-17H2,1H3,(H,23,24)(H2,22,25,26);1H |
| InChIKey | PCTXPRWRISMQFA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|