C20H28IN5S — CID 109464907
1-[2-(4-ethylphenyl)-2-methylpropyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 109464907) has the molecular formula C20H28IN5S and a molecular weight of 497.45 g/mol. Its IUPAC name is 1-[2-(4-ethylphenyl)-2-methylpropyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-ethylphenyl)-2-methylpropyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109464907 |
| Molecular Formula | C20H28IN5S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 1-[2-(4-ethylphenyl)-2-methylpropyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | CCc1ccc(C(C)(C)CN/C(=N\C)NCc2cn3ccsc3n2)cc1.I |
| InChI | InChI=1S/C20H27N5S.HI/c1-5-15-6-8-16(9-7-15)20(2,3)14-23-18(21-4)22-12-17-13-25-10-11-26-19(25)24-17;/h6-11,13H,5,12,14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | CEDRZDCPYKEYGR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|