C13H29IN4O2S2 — CID 111833200
1-ethyl-2-(2-methylpropyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111833200) has the molecular formula C13H29IN4O2S2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 1-ethyl-2-(2-methylpropyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methylpropyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111833200 |
| Molecular Formula | C13H29IN4O2S2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 1-ethyl-2-(2-methylpropyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C)NCCS(=O)(=O)N1CCSCC1.I |
| InChI | InChI=1S/C13H28N4O2S2.HI/c1-4-14-13(16-11-12(2)3)15-5-10-21(18,19)17-6-8-20-9-7-17;/h12H,4-11H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | SDEZKMIHHNLVKO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|