C18H26N4O3S2 — CID 111686580
1-ethyl-3-[2-(2-methylphenoxy)propyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111686580) has the molecular formula C18H26N4O3S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methylphenoxy)propyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-methylphenoxy)propyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111686580 |
| Molecular Formula | C18H26N4O3S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-ethyl-3-[2-(2-methylphenoxy)propyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)NCC(C)Oc1ccccc1C |
| InChI | InChI=1S/C18H26N4O3S2/c1-4-20-18(22-12-15-9-10-17(26-15)27(19,23)24)21-11-14(3)25-16-8-6-5-7-13(16)2/h5-10,14H,4,11-12H2,1-3H3,(H2,19,23,24)(H2,20,21,22) |
| InChIKey | LJCNGALIMFZVKZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|