C22H29F2IN4O — CID 111903514
N-tert-butyl-3-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111903514) has the molecular formula C22H29F2IN4O and a molecular weight of 530.40 g/mol. Its IUPAC name is N-tert-butyl-3-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-tert-butyl-3-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111903514 |
| Molecular Formula | C22H29F2IN4O |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | N-tert-butyl-3-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)(C)C)c1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C22H28F2N4O.HI/c1-5-25-21(27-14-17-12-18(23)9-10-19(17)24)26-13-15-7-6-8-16(11-15)20(29)28-22(2,3)4;/h6-12H,5,13-14H2,1-4H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | YDXIEVUHDUFJBL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|