C26H34N6O — CID 111851246
N-tert-butyl-3-[[[ethylamino-[[2-(pyrazol-1-ylmethyl)phenyl]methylamino]methylidene]amino]methyl]benzamide (PubChem CID 111851246) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is N-tert-butyl-3-[[[ethylamino-[[2-(pyrazol-1-ylmethyl)phenyl]methylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N-tert-butyl-3-[[[ethylamino-[[2-(pyrazol-1-ylmethyl)phenyl]methylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111851246 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | N-tert-butyl-3-[[[ethylamino-[[2-(pyrazol-1-ylmethyl)phenyl]methylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)(C)C)c1)NCc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C26H34N6O/c1-5-27-25(28-17-20-10-8-13-21(16-20)24(33)31-26(2,3)4)29-18-22-11-6-7-12-23(22)19-32-15-9-14-30-32/h6-16H,5,17-19H2,1-4H3,(H,31,33)(H2,27,28,29) |
| InChIKey | YKROSUJXZUKWAB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|