C23H29IN6O — CID 111850953
N-[3-[[[ethylamino-[[2-(pyrazol-1-ylmethyl)phenyl]methylamino]methylidene]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111850953) has the molecular formula C23H29IN6O and a molecular weight of 532.43 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[[2-(pyrazol-1-ylmethyl)phenyl]methylamino]methylidene]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[[2-(pyrazol-1-ylmethyl)phenyl]methylamino]methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111850953 |
| Molecular Formula | C23H29IN6O |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | N-[3-[[[ethylamino-[[2-(pyrazol-1-ylmethyl)phenyl]methylamino]methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(C)=O)c1)NCc1ccccc1Cn1cccn1.I |
| InChI | InChI=1S/C23H28N6O.HI/c1-3-24-23(25-15-19-8-6-11-22(14-19)28-18(2)30)26-16-20-9-4-5-10-21(20)17-29-13-7-12-27-29;/h4-14H,3,15-17H2,1-2H3,(H,28,30)(H2,24,25,26);1H |
| InChIKey | ZRZIFMZMQYEYMT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|