C23H28N6O — CID 111134217
N-[3-[[[ethylamino-(2-phenylethylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide (PubChem CID 111134217) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is N-[3-[[[ethylamino-(2-phenylethylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide.
| Compound Name | N-[3-[[[ethylamino-(2-phenylethylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 111134217 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-[3-[[[ethylamino-(2-phenylethylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)Cn2cccn2)c1)NCCc1ccccc1 |
| InChI | InChI=1S/C23H28N6O/c1-2-24-23(25-14-12-19-8-4-3-5-9-19)26-17-20-10-6-11-21(16-20)28-22(30)18-29-15-7-13-27-29/h3-11,13,15-16H,2,12,14,17-18H2,1H3,(H,28,30)(H2,24,25,26) |
| InChIKey | YFWGDVPCMMNGMN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|