C21H28N8O — CID 111905523
N-[3-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide (PubChem CID 111905523) has the molecular formula C21H28N8O and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[3-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide.
| Compound Name | N-[3-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 111905523 |
| Molecular Formula | C21H28N8O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N-[3-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)Cn2cccn2)c1)NCCCn1cccn1 |
| InChI | InChI=1S/C21H28N8O/c1-2-22-21(23-9-4-12-28-13-5-10-25-28)24-16-18-7-3-8-19(15-18)27-20(30)17-29-14-6-11-26-29/h3,5-8,10-11,13-15H,2,4,9,12,16-17H2,1H3,(H,27,30)(H2,22,23,24) |
| InChIKey | FPTXFJHEVKIVRL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|