C20H31IN6O2 — CID 111605820
N-[3-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide (PubChem CID 111605820) has the molecular formula C20H31IN6O2 and a molecular weight of 514.41 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111605820 |
| Molecular Formula | C20H31IN6O2 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-[3-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)Cn2cccn2)c1)NCC(C)(C)OC.I |
| InChI | InChI=1S/C20H30N6O2.HI/c1-5-21-19(23-15-20(2,3)28-4)22-13-16-8-6-9-17(12-16)25-18(27)14-26-11-7-10-24-26;/h6-12H,5,13-15H2,1-4H3,(H,25,27)(H2,21,22,23);1H |
| InChIKey | IFXWUYJZMPYGEG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|