C24H29FIN5O — CID 111889142
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111889142) has the molecular formula C24H29FIN5O and a molecular weight of 549.43 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111889142 |
| Molecular Formula | C24H29FIN5O |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2ccccc2C1)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C24H28FN5O.HI/c1-2-26-24(27-11-9-18-14-28-22-13-20(25)7-8-21(18)22)29-15-23(31)30-12-10-17-5-3-4-6-19(17)16-30;/h3-8,13-14,28H,2,9-12,15-16H2,1H3,(H2,26,27,29);1H |
| InChIKey | YLBREZOQSQYRRJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|