C22H27FIN5OS — CID 111972481
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111972481) has the molecular formula C22H27FIN5OS and a molecular weight of 555.46 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111972481 |
| Molecular Formula | C22H27FIN5OS |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2sccc2C1)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C22H26FN5OS.HI/c1-2-24-22(25-8-5-15-12-26-19-4-3-17(23)11-18(15)19)27-13-21(29)28-9-6-20-16(14-28)7-10-30-20;/h3-4,7,10-12,26H,2,5-6,8-9,13-14H2,1H3,(H2,24,25,27);1H |
| InChIKey | UAFKHVWNQHCMGT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|