C23H30IN5OS — CID 111974449
1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111974449) has the molecular formula C23H30IN5OS and a molecular weight of 551.50 g/mol. Its IUPAC name is 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111974449 |
| Molecular Formula | C23H30IN5OS |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 1-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)N1CCc2sccc2C1)NCCc1c[nH]c2cc(C)ccc12.I |
| InChI | InChI=1S/C23H29N5OS.HI/c1-16-3-4-19-17(14-27-20(19)13-16)5-9-25-23(24-2)26-10-6-22(29)28-11-7-21-18(15-28)8-12-30-21;/h3-4,8,12-14,27H,5-7,9-11,15H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | QKUNOVQYIOBZFW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|