C20H32FIN4O2 — CID 111972261
1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[4-(2-methoxyethoxy)butyl]guanidine;hydroiodide (PubChem CID 111972261) has the molecular formula C20H32FIN4O2 and a molecular weight of 506.40 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[4-(2-methoxyethoxy)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[4-(2-methoxyethoxy)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111972261 |
| Molecular Formula | C20H32FIN4O2 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[4-(2-methoxyethoxy)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCOCCOC)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C20H31FN4O2.HI/c1-3-22-20(23-9-4-5-11-27-13-12-26-2)24-10-8-16-15-25-19-7-6-17(21)14-18(16)19;/h6-7,14-15,25H,3-5,8-13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | VZNIWXQEJJRWDB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|