C24H29IN6 — CID 110997224
1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110997224) has the molecular formula C24H29IN6 and a molecular weight of 528.44 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110997224 |
| Molecular Formula | C24H29IN6 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cn1cccn1)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C24H28N6.HI/c1-2-25-24(26-14-12-20-17-27-23-11-6-5-10-22(20)23)28-16-19-8-3-4-9-21(19)18-30-15-7-13-29-30;/h3-11,13,15,17,27H,2,12,14,16,18H2,1H3,(H2,25,26,28);1H |
| InChIKey | RFYOKAZOUKGYTI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|