C23H26ClIN6O — CID 111588368
1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111588368) has the molecular formula C23H26ClIN6O and a molecular weight of 564.86 g/mol. Its IUPAC name is 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111588368 |
| Molecular Formula | C23H26ClIN6O |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(-c2cccc(Cl)c2)no1)NCCc1c[nH]c2cc(C)ccc12.I |
| InChI | InChI=1S/C23H25ClN6O.HI/c1-15-6-7-19-17(14-28-20(19)12-15)8-10-26-23(25-2)27-11-9-21-29-22(30-31-21)16-4-3-5-18(24)13-16;/h3-7,12-14,28H,8-11H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | KTWARLHCJVFTJZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|