C21H24ClN5O — CID 111554859
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[(2,4-dimethylphenyl)methyl]-2-methylguanidine (PubChem CID 111554859) has the molecular formula C21H24ClN5O and a molecular weight of 397.91 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[(2,4-dimethylphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[(2,4-dimethylphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111554859 |
| Molecular Formula | C21H24ClN5O |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[(2,4-dimethylphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1nc(-c2ccc(Cl)cc2)no1)NCc1ccc(C)cc1C |
| InChI | InChI=1S/C21H24ClN5O/c1-14-4-5-17(15(2)12-14)13-25-21(23-3)24-11-10-19-26-20(27-28-19)16-6-8-18(22)9-7-16/h4-9,12H,10-11,13H2,1-3H3,(H2,23,24,25) |
| InChIKey | AWPSUTWKUDNNSY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|