C18H31N7O — CID 111950915
1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111950915) has the molecular formula C18H31N7O and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111950915 |
| Molecular Formula | C18H31N7O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCCCc1nc(C(C)C)no1 |
| InChI | InChI=1S/C18H31N7O/c1-7-19-18(21-11-15-13(4)23-25(6)14(15)5)20-10-8-9-16-22-17(12(2)3)24-26-16/h12H,7-11H2,1-6H3,(H2,19,20,21) |
| InChIKey | NQORYSKNOQGZMO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|