C20H24ClN3O3 — CID 111379553
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-ethylguanidine (PubChem CID 111379553) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-ethylguanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111379553 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)cc1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H24ClN3O3/c1-2-22-20(24-12-17(25)15-4-6-16(21)7-5-15)23-10-9-14-3-8-18-19(11-14)27-13-26-18/h3-8,11,17,25H,2,9-10,12-13H2,1H3,(H2,22,23,24) |
| InChIKey | ZABHVHBTZJYKAW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|